Difference between revisions of "PWY0-1353"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1353 PWY0-1353] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1353 PWY0-1353] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
+
 
* common name:
 
* common name:
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
+
** succinate to cytochrome bd oxidase electron transfer
* molecular weight:
+
** 443.688   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-18]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
* [[RXN-13711]]
+
** 6 associated gene(s):
* [[RXN66-17]]
+
*** [[CHC_T00007584001_1]]
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00008943001_1]]
 +
*** [[CHC_T00007286001_1]]
 +
*** [[CHC_T00008943001]]
 +
*** [[CHC_T00006990001_1]]
 +
*** [[CHC_T00001817001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5266 RXN0-5266]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826592 91826592]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1353 PWY0-1353]
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87047 87047]
+
{{#set: common name=succinate to cytochrome bd oxidase electron transfer}}
* HMDB : HMDB12165
+
{{#set: reaction found=1}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}}
+
{{#set: total reaction=2}}
{{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}}
+
{{#set: completion rate=50.0}}
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=443.688    }}
+
{{#set: consumed by=RXN66-18}}
+
{{#set: produced by=RXN-13711|RXN66-17}}
+

Revision as of 16:34, 23 May 2018

Pathway PWY0-1353

  • taxonomic range:
  • common name:
    • succinate to cytochrome bd oxidase electron transfer
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links