Difference between revisions of "CPD-10793"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS CYS] == * smiles: ** C(S)C(C(=O)[O-])[N+] * inchi key: ** InChIKey=XUJNEKJLAYXESH-REOHCLBHS...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10793 CPD-10793] == * smiles: ** [CH](=O)C(=O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=NZ...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10793 CPD-10793] == |
* smiles: | * smiles: | ||
− | ** | + | ** [CH](=O)C(=O)COP(=O)([O-])[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L |
* common name: | * common name: | ||
− | ** | + | ** hydroxypyruvaldehyde phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 166.027 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2,3-dioxopropyl dihydrogen phosphate |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-17808]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[RXN- | + | |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16849 C16849] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.19993665.html 19993665] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58860 58860] |
− | * | + | * PUBCHEM: |
− | {{#set: smiles= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21126161 21126161] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=[CH](=O)C(=O)COP(=O)([O-])[O-]}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L}} |
− | {{#set: molecular weight= | + | {{#set: common name=hydroxypyruvaldehyde phosphate}} |
− | {{#set: common name= | + | {{#set: molecular weight=166.027 }} |
− | {{#set: consumed by= | + | {{#set: common name=2,3-dioxopropyl dihydrogen phosphate}} |
− | + | {{#set: consumed by=RXN-17808}} | |
− | + |
Revision as of 15:36, 23 May 2018
Contents
Metabolite CPD-10793
- smiles:
- [CH](=O)C(=O)COP(=O)([O-])[O-]
- inchi key:
- InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L
- common name:
- hydroxypyruvaldehyde phosphate
- molecular weight:
- 166.027
- Synonym(s):
- 2,3-dioxopropyl dihydrogen phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(=O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.