Difference between revisions of "CPD-19168"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-961 RXN-961] == * direction: ** LEFT-TO-RIGHT * common name: ** D-ribulose-1,5-bisphosphate cle...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] == * smiles: ** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| + | * inchi key: | ||
| + | ** InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA |
| − | * | + | * molecular weight: |
| − | + | ** 1015.898 | |
| − | + | ||
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (S)-3-hydroxy-16:1-Δ7-CoA |
| + | ** (S)-3-hydroxy-7-cis-hexadecenoyl-CoA | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-17781]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-17780]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: smiles=CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | + | {{#set: inchi key=InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J}} | |
| − | {{#set: | + | {{#set: common name=(S)-3-hydroxy-(7Z)-hexadecenoyl-CoA}} |
| − | + | {{#set: molecular weight=1015.898 }} | |
| − | {{#set: | + | {{#set: common name=(S)-3-hydroxy-16:1-Δ7-CoA|(S)-3-hydroxy-7-cis-hexadecenoyl-CoA}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN-17781}} |
| − | {{#set: | + | {{#set: produced by=RXN-17780}} |
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 15:39, 23 May 2018
Contents
Metabolite CPD-19168
- smiles:
- CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J
- common name:
- (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA
- molecular weight:
- 1015.898
- Synonym(s):
- (S)-3-hydroxy-16:1-Δ7-CoA
- (S)-3-hydroxy-7-cis-hexadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
