Difference between revisions of "NONMEVIPP-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7035 CPD-7035] == * smiles: ** C1(C=CC(CCO)=CC=1) * inchi key: ** InChIKey=WRMNZCZEMHIOCP-U...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7035 CPD-7035] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** C1(C=CC(CCO)=CC=1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=WRMNZCZEMHIOCP-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 2-phenylethanol
+
** methylerythritol phosphate pathway I
−
* molecular weight:
+
−
** 122.166   
+
 
* Synonym(s):
 
* Synonym(s):
−
** benzeneethanol
+
** nonmevalonate isopentenyl diphosphate biosynthesis
−
** phenethanol
+
** methylerythritol phosphate degradation
 +
** MEP degradation
 +
** deoxyxylulose phosphate pathway
 +
** DOXP pathway
 +
** Rohmer pathway
 +
** isopentenyl diphosphate biosynthesis -- mevalonate-independent
 +
** nonmevalonate isoprenoid pathway
 +
** MEP pathway
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''7''' reactions found over '''9''' reactions in the full pathway
−
* [[RXN-7700]]
+
* [[2.7.1.148-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00003708001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[DXPREDISOM-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009191001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[DXS-RXN]]
 +
** 9 associated gene(s):
 +
*** [[CHC_T00003402001_1]]
 +
*** [[CHC_T00008758001]]
 +
*** [[CHC_T00001454001_1]]
 +
*** [[CHC_T00000865001_1]]
 +
*** [[CHC_T00009061001_1]]
 +
*** [[CHC_T00008758001_1]]
 +
*** [[CHC_T00003376001_1]]
 +
*** [[CHC_T00001730001_1]]
 +
*** [[CHC_T00000866001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[IPPISOM-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00001581001_1]]
 +
*** [[CHC_T00006126001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[ISPH2-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008841001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN0-302]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009483001_1]]
 +
*** [[CHC_T00009483001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN0-884]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008841001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.7.7.60-RXN 2.7.7.60-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15878 RXN-15878]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB02192
+
* ECOCYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6054 6054]
+
* ARACYC:
−
* HMDB : HMDB33944
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY]
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05853 C05853]
+
{{#set: common name=methylerythritol phosphate pathway I}}
−
* CHEMSPIDER:
+
{{#set: common name=nonmevalonate isopentenyl diphosphate biosynthesis|methylerythritol phosphate degradation|MEP degradation|deoxyxylulose phosphate pathway|DOXP pathway|Rohmer pathway|isopentenyl diphosphate biosynthesis -- mevalonate-independent|nonmevalonate isoprenoid pathway|MEP pathway}}
−
** [http://www.chemspider.com/Chemical-Structure.5830.html 5830]
+
{{#set: reaction found=7}}
−
* CHEBI:
+
{{#set: total reaction=9}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49000 49000]
+
{{#set: completion rate=78.0}}
−
* METABOLIGHTS : MTBLC49000
+
−
{{#set: smiles=C1(C=CC(CCO)=CC=1)}}
+
−
{{#set: inchi key=InChIKey=WRMNZCZEMHIOCP-UHFFFAOYSA-N}}
+
−
{{#set: common name=2-phenylethanol}}
+
−
{{#set: molecular weight=122.166    }}
+
−
{{#set: common name=benzeneethanol|phenethanol}}
+
−
{{#set: produced by=RXN-7700}}
+

Revision as of 16:44, 23 May 2018

Pathway NONMEVIPP-PWY

  • taxonomic range:
  • common name:
    • methylerythritol phosphate pathway I
  • Synonym(s):
    • nonmevalonate isopentenyl diphosphate biosynthesis
    • methylerythritol phosphate degradation
    • MEP degradation
    • deoxyxylulose phosphate pathway
    • DOXP pathway
    • Rohmer pathway
    • isopentenyl diphosphate biosynthesis -- mevalonate-independent
    • nonmevalonate isoprenoid pathway
    • MEP pathway

Reaction(s) found

7 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=NONMEVIPP-PWY&oldid=15149"