Difference between revisions of "CHLOROPHYLL-A"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1K-87 RXN1K-87] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1K-87 RXN1K-87] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
 +
* common name:
 +
** chlorophyll a
 +
* molecular weight:
 +
** 892.495   
 
* Synonym(s):
 
* Synonym(s):
 +
** chlorophyll a (phytol)
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-787]][c] '''=>''' 1 [[CPD-786]][c]
+
* [[RXN-17428]]
−
* With common name(s):
+
* [[RXN-7666]]
−
** 1 (2Z,4Z)-2-hydroxyhepta-2,4-dienedioate[c] '''=>''' 1 (4Z)-2-oxohept-4-enedioate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN1F-66]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00010274001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* CAS : 479-61-8
−
** [http://www.genome.jp/dbget-bin/www_bget?R04134 R04134]
+
* PUBCHEM:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657767 90657767]
−
{{#set: gene associated=CHC_T00010274001_1}}
+
* KNAPSACK : C00001528
−
{{#set: in pathway=}}
+
* HMDB : HMDB38578
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05306 C05306]
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58416 58416]
 +
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
 +
{{#set: common name=chlorophyll a}}
 +
{{#set: molecular weight=892.495    }}
 +
{{#set: common name=chlorophyll a (phytol)}}
 +
{{#set: produced by=RXN-17428|RXN-7666}}
 +
{{#set: reversible reaction associated=RXN1F-66}}

Revision as of 15:47, 23 May 2018

Metabolite CHLOROPHYLL-A

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • chlorophyll a
  • molecular weight:
    • 892.495
  • Synonym(s):
    • chlorophyll a (phytol)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 479-61-8
  • PUBCHEM:
  • KNAPSACK : C00001528
  • HMDB : HMDB38578
  • LIGAND-CPD:
  • CHEBI:
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHLOROPHYLL-A&oldid=15302"