Difference between revisions of "TRANS-RXN1HP7-24"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14894 CPD-14894] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-24 TRANS-RXN1HP7-24] == * direction: ** LEFT-TO-RIGHT * common name: ** TRANS-RXN1HP7...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14894 CPD-14894] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-24 TRANS-RXN1HP7-24] ==
−
* smiles:
+
* direction:
−
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N
+
 
* common name:
 
* common name:
−
** ergosta-5,7-dienol
+
** TRANS-RXN1HP7-24
−
* molecular weight:
+
−
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-13883]]
+
** 1.0 [[Guanine-Nucleotides]][e] '''=>''' 1.0 [[Guanine-Nucleotides]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 a guanine nucleotide[e] '''=>''' 1.0 a guanine nucleotide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00000551001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5326970 5326970]
+
{{#set: common name=TRANS-RXN1HP7-24}}
−
* CHEBI:
+
{{#set: gene associated=CHC_T00000551001_1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66918 66918]
+
{{#set: in pathway=}}
−
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
−
{{#set: common name=ergosta-5,7-dienol}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=398.671    }}
+
−
{{#set: produced by=RXN-13883}}
+

Latest revision as of 15:48, 23 May 2018

Reaction TRANS-RXN1HP7-24

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • TRANS-RXN1HP7-24
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=TRANS-RXN1HP7-24&oldid=15352"