Difference between revisions of "CHC T00009574001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] == * smiles: ** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
(Created page with "Category:Gene == Gene CHC_T00009574001_1 == * Synonym(s): == Reactions associated == * Reaction: LEUCINE--TRNA-LIGASE-RXN ** Source: orthology-galdieria.sulphuraria...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] ==
+
== Gene CHC_T00009574001_1 ==
* smiles:
+
** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
+
* common name:
+
** (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
+
* molecular weight:
+
** 959.791   
+
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-12:1-Δ5-CoA
 
** (S)-3-hydroxy-5-cis-dodecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17798]]
+
* Reaction: [[LEUCINE--TRNA-LIGASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-galdieria.sulphuraria]]
* [[RXN-17797]]
+
** Source: [[orthology-ectocarpus_siliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=LEUCINE--TRNA-LIGASE-RXN}}
{{#set: inchi key=InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J}}
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
{{#set: common name=(S)-3-hydroxy-(5Z)-dodecenoyl-CoA}}
+
{{#set: molecular weight=959.791    }}
+
{{#set: common name=(S)-3-hydroxy-12:1-Δ5-CoA|(S)-3-hydroxy-5-cis-dodecenoyl-CoA}}
+
{{#set: consumed by=RXN-17798}}
+
{{#set: produced by=RXN-17797}}
+

Latest revision as of 15:51, 23 May 2018

Gene CHC_T00009574001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links