Difference between revisions of "CHC T00008865001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ALLANTOIN S-ALLANTOIN] == * smiles: ** C1(NC(N)=O)(NC(=O)NC(=O)1) * inchi key: ** InChIKey=PO...") |
(Created page with "Category:Gene == Gene CHC_T00008865001 == * left end position: ** 27956 * transcription direction: ** POSITIVE * right end position: ** 28885 * centisome position: ** 11.3...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008865001 == |
− | * | + | * left end position: |
− | ** | + | ** 27956 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 28885 |
− | * | + | * centisome position: |
− | ** | + | ** 11.300284 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PRPPSYN-RXN]] |
− | + | ** Source: [[annotation-original_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
+ | * [[PWY0-662]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=27956}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=28885}} | |
− | + | {{#set: centisome position=11.300284 }} | |
− | + | {{#set: reaction associated=PRPPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY0-662}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 15:51, 23 May 2018
Gene CHC_T00008865001
- left end position:
- 27956
- transcription direction:
- POSITIVE
- right end position:
- 28885
- centisome position:
- 11.300284
- Synonym(s):
Reactions associated
- Reaction: PRPPSYN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome