Difference between revisions of "CPD-474"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16313 RXN-16313] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * i...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16313 RXN-16313] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.2.24 EC-2.3.2.24]
+
** InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
 +
* common name:
 +
** (+)-taxifolin
 +
* molecular weight:
 +
** 303.248   
 
* Synonym(s):
 
* Synonym(s):
 +
** trans dihydroquercetin
 +
** (+)-dihydroquercetin
 +
** taxifolin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-600]]
−
** 1 [[S-ubiquitinyl-E3-independent-E2-Cys]][c] '''+''' 1 [[Protein-L-lysine]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[PROTEIN-N-UBIQUITYL-LYSINE]][c] '''+''' 1 [[E3-independent-Ubiquitin-E2-L-cysteine]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an S-ubiquitinyl-[(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine[c] '''+''' 1 a [protein]-L-lysine[c] '''=>''' 1 H+[c] '''+''' 1 an N6-monoubiquitinyl-[protein]-L-lysine[c] '''+''' 1 an [(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00002999001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-7511]], protein ubiquitylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7511 PWY-7511]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 480-18-2
−
{{#set: ec number=EC-2.3.2.24}}
+
* PUBCHEM:
−
{{#set: gene associated=CHC_T00002999001_1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244891 25244891]
−
{{#set: in pathway=PWY-7511}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58329 58329]
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01617 C01617]
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M}}
−
{{#set: reconstruction source=original_genome}}
+
{{#set: common name=(+)-taxifolin}}
 +
{{#set: molecular weight=303.248    }}
 +
{{#set: common name=trans dihydroquercetin|(+)-dihydroquercetin|taxifolin}}
 +
{{#set: consumed by=RXN-600}}

Revision as of 15:52, 23 May 2018

Metabolite CPD-474

  • smiles:
    • C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
  • inchi key:
    • InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
  • common name:
    • (+)-taxifolin
  • molecular weight:
    • 303.248
  • Synonym(s):
    • trans dihydroquercetin
    • (+)-dihydroquercetin
    • taxifolin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-474&oldid=15540"