Difference between revisions of "CPD-5"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5 CPD-5] == * common name: ** a [FeS] iron-sulfur cluster * Synonym(s): ** a [FeS] iron-sul...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5 CPD-5] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a [FeS] iron-sulfur cluster |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a [FeS] iron-sulfur center |
| + | ** a FeS cluster | ||
| + | ** a FeS center | ||
| + | ** [FeS] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[TRANS-RXN1HP7-36]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[TRANS-RXN1HP7-36]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a [FeS] iron-sulfur cluster}} | |
| − | + | {{#set: common name=a [FeS] iron-sulfur center|a FeS cluster|a FeS center|[FeS]}} | |
| − | + | {{#set: consumed by=TRANS-RXN1HP7-36}} | |
| − | + | {{#set: produced by=TRANS-RXN1HP7-36}} | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | {{#set: produced by= | + | |
Latest revision as of 15:53, 23 May 2018
Contents
Metabolite CPD-5
- common name:
- a [FeS] iron-sulfur cluster
- Synonym(s):
- a [FeS] iron-sulfur center
- a FeS cluster
- a FeS center
- [FeS]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [FeS] iron-sulfur cluster" cannot be used as a page name in this wiki.
"a [FeS] iron-sulfur center" cannot be used as a page name in this wiki.
