Difference between revisions of "CHC T00009568001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * smiles: ** C(=O)([O-])CCCCCCCC=...")
(Created page with "Category:Gene == Gene CHC_T00009568001 == * left end position: ** 89813 * transcription direction: ** POSITIVE * right end position: ** 90748 * centisome position: ** 44.6...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] ==
+
== Gene CHC_T00009568001 ==
* smiles:
+
* left end position:
** C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
+
** 89813
* inchi key:
+
* transcription direction:
** InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
+
** POSITIVE
* common name:
+
* right end position:
** α,ω-9Z-octadecenedioate
+
** 90748
* molecular weight:
+
* centisome position:
** 310.433    
+
** 44.698654    
 
* Synonym(s):
 
* Synonym(s):
** α,ω-9Z-octadecenedioic acid
 
** 1,18-9Z-octadecenedioic acid
 
** octadecenedioate
 
** 18-carboxyl oleate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-16418]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=89813}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657642 90657642]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]}}
+
{{#set: right end position=90748}}
{{#set: inchi key=InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L}}
+
{{#set: centisome position=44.698654   }}
{{#set: common name=α,ω-9Z-octadecenedioate}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
{{#set: molecular weight=310.433   }}
+
{{#set: common name=α,ω-9Z-octadecenedioic acid|1,18-9Z-octadecenedioic acid|octadecenedioate|18-carboxyl oleate}}
+
{{#set: consumed by=RXN-16418}}
+

Latest revision as of 16:54, 23 May 2018

Gene CHC_T00009568001

  • left end position:
    • 89813
  • transcription direction:
    • POSITIVE
  • right end position:
    • 90748
  • centisome position:
    • 44.698654
  • Synonym(s):

Reactions associated

Pathways associated

External links