Difference between revisions of "SHIKIMATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ENOYL-ACP-REDUCT-NADH-RXN ENOYL-ACP-REDUCT-NADH-RXN] == * direction: ** LEFT-TO-RIGHT * common name...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ENOYL-ACP-REDUCT-NADH-RXN ENOYL-ACP-REDUCT-NADH-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])
 +
* inchi key:
 +
** InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M
 
* common name:
 
* common name:
** 2,3,4-saturated-fatty-acid-[acp] reductase
+
** shikimate
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** 173.145   
 
* Synonym(s):
 
* Synonym(s):
 +
** shikimic acid
 +
** (3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-7968]]
** 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[TRANS-D2-ENOYL-ACP]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Saturated-Fatty-Acyl-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
** 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 a trans-2-enoyl-[acyl-carrier protein][c] '''=>''' 1 NAD+[c] '''+''' 1 a 2,3,4-saturated fatty acyl-[acp][c]
+
== Reaction(s) of unknown directionality ==
 
+
* [[SHIKIMATE-KINASE-RXN]]
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00009325001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[FASYN-ELONG-PWY]], fatty acid elongation -- saturated: [http://metacyc.org/META/NEW-IMAGE?object=FASYN-ELONG-PWY FASYN-ELONG-PWY]
+
** '''3''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
* UNIPROT:
+
* CAS : 138-59-0
** [http://www.uniprot.org/uniprot/P16657 P16657]
+
* PUBCHEM:
** [http://www.uniprot.org/uniprot/O24990 O24990]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7057976 7057976]
** [http://www.uniprot.org/uniprot/Q9JSS8 Q9JSS8]
+
* HMDB : HMDB03070
** [http://www.uniprot.org/uniprot/P0A5Y6 P0A5Y6]
+
* LIGAND-CPD:
** [http://www.uniprot.org/uniprot/O84106 O84106]
+
** [http://www.genome.jp/dbget-bin/www_bget?C00493 C00493]
** [http://www.uniprot.org/uniprot/Q9PMQ7 Q9PMQ7]
+
* CHEMSPIDER:
** [http://www.uniprot.org/uniprot/P07149 P07149]
+
** [http://www.chemspider.com/Chemical-Structure.5414360.html 5414360]
** [http://www.uniprot.org/uniprot/P0AEK4 P0AEK4]
+
* CHEBI:
** [http://www.uniprot.org/uniprot/Q51891 Q51891]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36208 36208]
** [http://www.uniprot.org/uniprot/O04945 O04945]
+
* BIGG : skm
** [http://www.uniprot.org/uniprot/O04946 O04946]
+
{{#set: smiles=C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])}}
** [http://www.uniprot.org/uniprot/O24207 O24207]
+
{{#set: inchi key=InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M}}
** [http://www.uniprot.org/uniprot/P93062 P93062]
+
{{#set: common name=shikimate}}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: molecular weight=173.145    }}
{{#set: common name=2,3,4-saturated-fatty-acid-[acp] reductase}}
+
{{#set: common name=shikimic acid|(3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate}}
{{#set: ec number=EC-1.3.1.9}}
+
{{#set: consumed by=RXN-7968}}
{{#set: gene associated=CHC_T00009325001_1}}
+
{{#set: produced by=SHIKIMATE-5-DEHYDROGENASE-RXN}}
{{#set: in pathway=FASYN-ELONG-PWY}}
+
{{#set: reversible reaction associated=SHIKIMATE-KINASE-RXN}}
{{#set: reconstruction category=orthology}}
+
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=galdieria.sulphuraria}}
+

Revision as of 16:54, 23 May 2018

Metabolite SHIKIMATE

  • smiles:
    • C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])
  • inchi key:
    • InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M
  • common name:
    • shikimate
  • molecular weight:
    • 173.145
  • Synonym(s):
    • shikimic acid
    • (3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])" cannot be used as a page name in this wiki.