Difference between revisions of "CHC T00009232001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * smiles: ** C(=O)([O-])CCCCCCCC=...")
 
(Created page with "Category:Gene == Gene CHC_T00009232001_1 == * Synonym(s): == Reactions associated == * Reaction: 3.6.4.4-RXN ** Source: orthology-ectocarpus_siliculosus == Pathwa...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] ==
+
== Gene CHC_T00009232001_1 ==
* smiles:
+
** C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
+
* inchi key:
+
** InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
+
* common name:
+
** α,ω-9Z-octadecenedioate
+
* molecular weight:
+
** 310.433   
+
 
* Synonym(s):
 
* Synonym(s):
** α,ω-9Z-octadecenedioic acid
 
** 1,18-9Z-octadecenedioic acid
 
** octadecenedioate
 
** 18-carboxyl oleate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-16418]]
+
* Reaction: [[3.6.4.4-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=3.6.4.4-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657642 90657642]
+
{{#set: smiles=C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]}}
+
{{#set: inchi key=InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L}}
+
{{#set: common name=α,ω-9Z-octadecenedioate}}
+
{{#set: molecular weight=310.433    }}
+
{{#set: common name=α,ω-9Z-octadecenedioic acid|1,18-9Z-octadecenedioic acid|octadecenedioate|18-carboxyl oleate}}
+
{{#set: consumed by=RXN-16418}}
+

Latest revision as of 15:57, 23 May 2018

Gene CHC_T00009232001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links