Difference between revisions of "PWY-5686"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLSERINE ACETYLSERINE] == * smiles: ** CC(OCC([N+])C(=O)[O-])=O * inchi key: ** InChIKey=VZ...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5686 PWY-5686] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLSERINE ACETYLSERINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5686 PWY-5686] ==
* smiles:
+
* taxonomic range:
** CC(OCC([N+])C(=O)[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=VZXPDPZARILFQX-BYPYZUCNSA-N
+
 
* common name:
 
* common name:
** O-acetyl-L-serine
+
** UMP biosynthesis I
* molecular weight:
+
** 147.13   
+
 
* Synonym(s):
 
* Synonym(s):
** O3-acetyl-L-serine
+
** uridine-5'-phosphate biosynthesis I
** acetylserine
+
** de novo biosynthesis of uridine-5'-phosphate I
** O-acetylserine
+
** de novo biosynthesis of uridine-5'-monophosphate I
** (2S)-3-acetyloxy-2-aminopropanoate
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-12726]]
+
'''5''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ASPCARBTRANS-RXN]]
* [[SERINE-O-ACETTRAN-RXN]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00010056001_1]]
* [[ACSERLY-RXN]]
+
*** [[CHC_T00005123001_1]]
* [[SULFOCYS-RXN]]
+
** 2 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[CARBPSYN-RXN]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00008596001_1]]
 +
*** [[CHC_70]]
 +
*** [[CHC_T00010056001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[DIHYDROOROT-RXN]]
 +
** 5 associated gene(s):
 +
*** [[CHC_T00010056001]]
 +
*** [[CHC_T00010056001_1]]
 +
*** [[CHC_T00005381001_1]]
 +
*** [[CHC_T00008596001_1]]
 +
*** [[CHC_T00006412001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[OROPRIBTRANS-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00002698001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[OROTPDECARB-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00002698001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROOROTATE-DEHYDROGENASE-RXN DIHYDROOROTATE-DEHYDROGENASE-RXN]
 
== External links  ==
 
== External links  ==
* CAS : 66638-22-0
+
* ECOCYC:
* METABOLIGHTS : MTBLC17981
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5686 PWY-5686]
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971051 6971051]
+
{{#set: taxonomic range=TAX-2}}
* HMDB : HMDB03011
+
{{#set: common name=UMP biosynthesis I}}
* LIGAND-CPD:
+
{{#set: common name=uridine-5'-phosphate biosynthesis I|de novo biosynthesis of uridine-5'-phosphate I|de novo biosynthesis of uridine-5'-monophosphate I}}
** [http://www.genome.jp/dbget-bin/www_bget?C00979 C00979]
+
{{#set: reaction found=5}}
* CHEBI:
+
{{#set: total reaction=6}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58340 58340]
+
{{#set: completion rate=83.0}}
* BIGG : acser
+
{{#set: smiles=CC(OCC([N+])C(=O)[O-])=O}}
+
{{#set: inchi key=InChIKey=VZXPDPZARILFQX-BYPYZUCNSA-N}}
+
{{#set: common name=O-acetyl-L-serine}}
+
{{#set: molecular weight=147.13    }}
+
{{#set: common name=O3-acetyl-L-serine|acetylserine|O-acetylserine|(2S)-3-acetyloxy-2-aminopropanoate}}
+
{{#set: consumed by=RXN-12726}}
+
{{#set: produced by=SERINE-O-ACETTRAN-RXN}}
+
{{#set: consumed or produced by=ACSERLY-RXN|SULFOCYS-RXN}}
+

Revision as of 16:57, 23 May 2018

Pathway PWY-5686

  • taxonomic range:
  • common name:
    • UMP biosynthesis I
  • Synonym(s):
    • uridine-5'-phosphate biosynthesis I
    • de novo biosynthesis of uridine-5'-phosphate I
    • de novo biosynthesis of uridine-5'-monophosphate I

Reaction(s) found

5 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links