Difference between revisions of "CHC T00008561001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * smiles: ** C([O-])(=O)C(=O)CC1(=CC=CC=C1) * inchi key: **...") |
(Created page with "Category:Gene == Gene CHC_T00008561001_1 == * Synonym(s): == Reactions associated == * Reaction: IGPSYN-RXN ** Source: orthology-galdieria.sulphuraria ** Source:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008561001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[IGPSYN-RXN]] |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | + | ** Source: [[orthology-ectocarpus_siliculosus]] | |
− | + | ** Source: [[orthology-arabidopsis_thaliana]] | |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[TRPSYN-PWY]] |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=IGPSYN-RXN}} | |
− | + | {{#set: pathway associated=TRPSYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 17:02, 23 May 2018
Gene CHC_T00008561001_1
- Synonym(s):
Reactions associated
- Reaction: IGPSYN-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana