Difference between revisions of "RXN66-28"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP(OP([O-])([O-])=O)([O-])=O *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-28 RXN66-28] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-28 RXN66-28] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1.72 EC-1.3.1.72] |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[PROTON]][c] '''+''' 1 [[DESMOSTEROL-CPD]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[CHOLESTEROL]][c] '''+''' 1 [[NADP]][c] | |
| − | + | * With common name(s): | |
| − | + | ** 1 H+[c] '''+''' 1 desmosterol[c] '''+''' 1 NADPH[c] '''=>''' 1 cholesterol[c] '''+''' 1 NADP+[c] | |
| − | * [[ | + | |
| − | == | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[CHC_T00002789001_1]] |
| − | * [[ | + | ** Source: [[orthology-arabidopsis_thaliana]] |
| − | * [[ | + | == Pathways == |
| − | * [[ | + | * [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4] |
| − | + | ** '''16''' reactions found over '''22''' reactions in the full pathway | |
| − | * [[ | + | == Reconstruction information == |
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-arabidopsis_thaliana]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01457 R01457] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-1.3.1.72}} | |
| − | + | {{#set: gene associated=CHC_T00002789001_1}} | |
| − | * LIGAND- | + | {{#set: in pathway=PWY66-4}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=orthology}} |
| − | + | {{#set: reconstruction source=orthology-arabidopsis_thaliana}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 16:04, 23 May 2018
Contents
Reaction RXN66-28
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 DESMOSTEROL-CPD[c] + 1 NADPH[c] => 1 CHOLESTEROL[c] + 1 NADP[c]
- With common name(s):
- 1 H+[c] + 1 desmosterol[c] + 1 NADPH[c] => 1 cholesterol[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00002789001_1
- Source: orthology-arabidopsis_thaliana
Pathways
- PWY66-4, cholesterol biosynthesis III (via desmosterol): PWY66-4
- 16 reactions found over 22 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-arabidopsis_thaliana
- Tool: pantograph
- Source: orthology-arabidopsis_thaliana
External links
- LIGAND-RXN:
