Difference between revisions of "CHC T00009450001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...") |
(Created page with "Category:Gene == Gene CHC_T00009450001 == * left end position: ** 110048 * transcription direction: ** NEGATIVE * right end position: ** 111394 * centisome position: ** 73...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009450001 == |
− | * | + | * left end position: |
− | ** | + | ** 110048 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 111394 |
− | * | + | * centisome position: |
− | ** | + | ** 73.381966 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[LYSOPHOSPHOLIPASE-RXN]] |
− | + | ** Source: [[annotation-original_genome]] | |
− | * [[RXN- | + | *** Assignment: automated-name-match |
− | == | + | * Reaction: [[RXN-15035]] |
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7409]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=110048}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=111394}} |
− | {{#set: | + | {{#set: centisome position=73.381966 }} |
− | {{#set: | + | {{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-15035}} |
− | {{#set: | + | {{#set: pathway associated=PWY-7409}} |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 17:04, 23 May 2018
Gene CHC_T00009450001
- left end position:
- 110048
- transcription direction:
- NEGATIVE
- right end position:
- 111394
- centisome position:
- 73.381966
- Synonym(s):
Reactions associated
- Reaction: LYSOPHOSPHOLIPASE-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-15035
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome