Difference between revisions of "PWY-5078"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == * smiles: ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) * inchi key: ** InChIK...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5078 PWY-5078] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5078 PWY-5078] ==
* smiles:
+
* taxonomic range:
** C1(C(=O)NC(=O)NC(C(=O)[O-])1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=UFIVEPVSAGBUSI-REOHCLBHSA-M
+
 
* common name:
 
* common name:
** (S)-dihydroorotate
+
** L-isoleucine degradation II
* molecular weight:
+
** 157.105   
+
 
* Synonym(s):
 
* Synonym(s):
** dihydro-L-orotate
+
** Ehrlich pathway
** (S)-4,5-dihydroorotate
+
** (S)-4,5-dihydroorotic acid
+
** (S)-hydroorotic acid
+
** (S)-di-H-orotate
+
** L-dihydroorotate
+
** 4,5-dihydro-L-orotate
+
** L-4,5-dihydroorotate
+
** (S)-4-pyrimidinecarboxylic acid
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[4.1.1.72-RXN]]
* [[DIHYDROOROT-RXN]]
+
** 1 associated gene(s):
 +
*** [[CHC_T00008584001]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00003864001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-7694]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00010066001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 5988-19-2
+
{{#set: taxonomic range=TAX-4751}}
* CAS : 155-54-4
+
{{#set: common name=L-isoleucine degradation II}}
* METABOLIGHTS : MTBLC30864
+
{{#set: common name=Ehrlich pathway}}
* PUBCHEM:
+
{{#set: reaction found=3}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460289 5460289]
+
{{#set: total reaction=3}}
* HMDB : HMDB00528
+
{{#set: completion rate=100.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00337 C00337]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4573876.html 4573876]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30864 30864]
+
* BIGG : dhor__S
+
{{#set: smiles=C1(C(=O)NC(=O)NC(C(=O)[O-])1)}}
+
{{#set: inchi key=InChIKey=UFIVEPVSAGBUSI-REOHCLBHSA-M}}
+
{{#set: common name=(S)-dihydroorotate}}
+
{{#set: molecular weight=157.105    }}
+
{{#set: common name=dihydro-L-orotate|(S)-4,5-dihydroorotate|(S)-4,5-dihydroorotic acid|(S)-hydroorotic acid|(S)-di-H-orotate|L-dihydroorotate|4,5-dihydro-L-orotate|L-4,5-dihydroorotate|(S)-4-pyrimidinecarboxylic acid}}
+
{{#set: consumed or produced by=DIHYDROOROT-RXN}}
+

Revision as of 16:04, 23 May 2018

Pathway PWY-5078

  • taxonomic range:
  • common name:
    • L-isoleucine degradation II
  • Synonym(s):
    • Ehrlich pathway

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links