Difference between revisions of "CPD-19220"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_1145 == * left end position: ** 175326 * transcription direction: ** NEGATIVE * right end position: ** 175676 * common name: ** ftrB * centisome...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19220 CPD-19220] == * smiles: ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) * common name: ** (S)-demethy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19220 CPD-19220] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (S)-demethyl-4-deoxygadusol |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=OWHGXOODGNBQRG-ZETCQYMHSA-N |
+ | * molecular weight: | ||
+ | ** 174.153 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-17896]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[RXN-17895]] |
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=C(O)C1(O)(CC(=O)C(O)=C(O)C1)}} |
− | {{#set: | + | {{#set: common name=(S)-demethyl-4-deoxygadusol}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=OWHGXOODGNBQRG-ZETCQYMHSA-N}} |
− | {{#set: common name= | + | {{#set: molecular weight=174.153 }} |
− | {{#set: | + | {{#set: common name=(5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one}} |
− | {{#set: reaction associated=RXN- | + | {{#set: consumed by=RXN-17896}} |
+ | {{#set: reversible reaction associated=RXN-17895}} |
Revision as of 16:05, 23 May 2018
Contents
Metabolite CPD-19220
- smiles:
- C(O)C1(O)(CC(=O)C(O)=C(O)C1)
- common name:
- (S)-demethyl-4-deoxygadusol
- inchi key:
- InChIKey=OWHGXOODGNBQRG-ZETCQYMHSA-N
- molecular weight:
- 174.153
- Synonym(s):
- (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one