Difference between revisions of "CHC T00009439001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...")
(Created page with "Category:Gene == Gene CHC_T00009439001 == * left end position: ** 44909 * transcription direction: ** POSITIVE * right end position: ** 46828 * centisome position: ** 86.9...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] ==
+
== Gene CHC_T00009439001 ==
* smiles:
+
* left end position:
** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O
+
** 44909
* inchi key:
+
* transcription direction:
** InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N
+
** POSITIVE
* common name:
+
* right end position:
** 4-hydroxy-2-nonenal-[Cys-Gly] conjugate
+
** 46828
* molecular weight:
+
* centisome position:
** 334.43    
+
** 86.91672    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-13677]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=44909}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659346 90659346]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O}}
+
{{#set: right end position=46828}}
{{#set: inchi key=InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N}}
+
{{#set: centisome position=86.91672   }}
{{#set: common name=4-hydroxy-2-nonenal-[Cys-Gly] conjugate}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
{{#set: molecular weight=334.43   }}
+
{{#set: consumed by=RXN-13677}}
+

Latest revision as of 16:06, 23 May 2018

Gene CHC_T00009439001

  • left end position:
    • 44909
  • transcription direction:
    • POSITIVE
  • right end position:
    • 46828
  • centisome position:
    • 86.91672
  • Synonym(s):

Reactions associated

Pathways associated

External links