Difference between revisions of "PWY-6181"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * smiles: ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6181 PWY-6181] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6181 PWY-6181] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** histamine degradation |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | * [[RXN-10089]] |
| − | == Reaction(s) | + | ** 3 associated gene(s): |
| + | *** [[CHC_T00008341001]] | ||
| + | *** [[CHC_T00008341001_1]] | ||
| + | *** [[CHC_T00008575001_1]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE-N-METHYLTRANSFERASE-RXN HISTAMINE-N-METHYLTRANSFERASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9600 RXN-9600] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-MAP: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?map00340 map00340] | |
| − | * LIGAND- | + | {{#set: taxonomic range=TAX-33208}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=histamine degradation}} |
| − | + | {{#set: reaction found=1}} | |
| − | {{#set: | + | {{#set: total reaction=3}} |
| − | {{#set: | + | {{#set: completion rate=33.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:06, 23 May 2018
Pathway PWY-6181
- taxonomic range:
- common name:
- histamine degradation
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN-10089
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
Reaction(s) not found
External links
- LIGAND-MAP:
