Difference between revisions of "CHC T00001389001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] == * smiles: ** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
 
(Created page with "Category:Gene == Gene CHC_T00001389001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN-8999 ** Source: orthology-ectocarpus_siliculosus ** Source: [...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] ==
+
== Gene CHC_T00001389001_1 ==
−
* smiles:
+
−
** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J
+
−
* common name:
+
−
** 3-hydroxy-5-methylhex-4-enoyl-CoA
+
−
* molecular weight:
+
−
** 889.657   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-8999]]
−
* [[RXN-11919]]
+
** Source: [[orthology-ectocarpus_siliculosus]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Reaction: [[RXN0-5180]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways associated ==
 +
* [[PWY-5785]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=RXN-8999|RXN0-5180}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986102 50986102]
+
{{#set: pathway associated=PWY-5785}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C16469 C16469]
+
−
* HMDB : HMDB60373
+
−
{{#set: smiles=CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J}}
+
−
{{#set: common name=3-hydroxy-5-methylhex-4-enoyl-CoA}}
+
−
{{#set: molecular weight=889.657    }}
+
−
{{#set: produced by=RXN-11919}}
+

Latest revision as of 17:07, 23 May 2018

Gene CHC_T00001389001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00001389001_1&oldid=16226"