Difference between revisions of "CPD-18077"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18077 CPD-18077] == * common name: ** a [protein]-L-asparagine-[(glucosyl)3(mannosyl)9(N-ac...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18077 CPD-18077] ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
* inchi key:
+
** InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J
+
 
* common name:
 
* common name:
** sinapoyl-CoA
+
** a [protein]-L-asparagine-[(glucosyl)3(mannosyl)9(N-acetylglucosaminyl)2]
* molecular weight:
+
** 969.7   
+
 
* Synonym(s):
 
* Synonym(s):
** sinapinoyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10919]]
+
* [[2.4.1.119-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-1124]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [protein]-L-asparagine-[(glucosyl)3(mannosyl)9(N-acetylglucosaminyl)2]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229225 44229225]
+
{{#set: produced by=2.4.1.119-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57393 57393]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00411 C00411]
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J}}
+
{{#set: common name=sinapoyl-CoA}}
+
{{#set: molecular weight=969.7    }}
+
{{#set: common name=sinapinoyl-CoA}}
+
{{#set: produced by=RXN-10919}}
+
{{#set: consumed or produced by=RXN-1124}}
+

Latest revision as of 17:07, 23 May 2018

Metabolite CPD-18077

  • common name:
    • a [protein]-L-asparagine-[(glucosyl)3(mannosyl)9(N-acetylglucosaminyl)2]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein]-L-asparagine-[(glucosyl)3(mannosyl)9(N-acetylglucosaminyl)2" cannot be used as a page name in this wiki.