Difference between revisions of "CHC T00008003001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...")
 
(Created page with "Category:Gene == Gene CHC_T00008003001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN-14389 ** Source: orthology-galdieria.sulphuraria * Reaction:...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] ==
+
== Gene CHC_T00008003001_1 ==
* smiles:
+
** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
+
* inchi key:
+
** InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
+
* common name:
+
** 5'-hydroxycotinine
+
* molecular weight:
+
** 192.217   
+
 
* Synonym(s):
 
* Synonym(s):
** allohydroxycotinine
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-14389]]
* [[RXN66-163]]
+
** Source: [[orthology-galdieria.sulphuraria]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-14390]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Reaction: [[RXN-14391]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways associated ==
 +
* [[PWY-7250]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-14389|RXN-14390|RXN-14391}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9815515 9815515]
+
{{#set: pathway associated=PWY-7250}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.7991265.html 7991265]
+
* HMDB : HMDB01427
+
{{#set: smiles=C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))}}
+
{{#set: inchi key=InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N}}
+
{{#set: common name=5'-hydroxycotinine}}
+
{{#set: molecular weight=192.217    }}
+
{{#set: common name=allohydroxycotinine}}
+
{{#set: produced by=RXN66-163}}
+

Latest revision as of 16:07, 23 May 2018

Gene CHC_T00008003001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links