Difference between revisions of "CPD-15677"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00009398001 == * left end position: ** 156175 * transcription direction: ** NEGATIVE * right end position: ** 157692 * centisome position: ** 83...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] == * smiles: ** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00009398001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] ==
* left end position:
+
* smiles:
** 156175
+
** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J
* right end position:
+
* common name:
** 157692
+
** 4-trans-undecenoyl-CoA
* centisome position:
+
* molecular weight:
** 83.245384    
+
** 929.765    
 
* Synonym(s):
 
* Synonym(s):
 +
** 4E-undecenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[CYSTEINE--TRNA-LIGASE-RXN]]
+
* [[RXN-14789]]
** original_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
* [[RXN-14788]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[TRNA-CHARGING-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=156175}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658640 90658640]
{{#set: right end position=157692}}
+
{{#set: smiles=CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: centisome position=83.245384   }}
+
{{#set: inchi key=InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J}}
{{#set: reaction associated=CYSTEINE--TRNA-LIGASE-RXN}}
+
{{#set: common name=4-trans-undecenoyl-CoA}}
{{#set: pathway associated=TRNA-CHARGING-PWY}}
+
{{#set: molecular weight=929.765   }}
 +
{{#set: common name=4E-undecenoyl-CoA}}
 +
{{#set: consumed by=RXN-14789}}
 +
{{#set: produced by=RXN-14788}}

Revision as of 16:09, 23 May 2018

Metabolite CPD-15677

  • smiles:
    • CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J
  • common name:
    • 4-trans-undecenoyl-CoA
  • molecular weight:
    • 929.765
  • Synonym(s):
    • 4E-undecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.