Difference between revisions of "CHC T00008640001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCMP DCMP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O * inchi key: **...") |
(Created page with "Category:Gene == Gene CHC_T00008640001 == * left end position: ** 356279 * transcription direction: ** NEGATIVE * right end position: ** 357172 * centisome position: ** 30...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008640001 == |
− | * | + | * left end position: |
− | ** | + | ** 356279 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 357172 |
− | * | + | * centisome position: |
− | ** | + | ** 30.39109 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-12440]] |
− | * [[RXN- | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | * Reaction: [[RXN-3521]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
− | + | * [[PWY-6960]] | |
+ | * [[PWY-6959]] | ||
+ | * [[PWY-6961]] | ||
+ | * [[PWY-2261]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=356279}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=357172}} | |
− | + | {{#set: centisome position=30.39109 }} | |
− | + | {{#set: reaction associated=RXN-12440|RXN-3521}} | |
− | + | {{#set: pathway associated=PWY-6960|PWY-6959|PWY-6961|PWY-2261}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:09, 23 May 2018
Gene CHC_T00008640001
- left end position:
- 356279
- transcription direction:
- NEGATIVE
- right end position:
- 357172
- centisome position:
- 30.39109
- Synonym(s):
Reactions associated
- Reaction: RXN-12440
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-3521
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome