Difference between revisions of "CHC T00002450001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11878 CPD-11878] == * smiles: ** C(O)C(O)C1(C=CC(O)=C(O)C=1) * inchi key: ** InChIKey=MTVWF...") |
(Created page with "Category:Gene == Gene CHC_T00002450001_1 == * Synonym(s): == Reactions associated == * Reaction: TRANS-RXN1HP7-31 ** Source: orthology-galdieria.sulphuraria == Pa...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00002450001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[TRANS-RXN1HP7-31]] | |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=TRANS-RXN1HP7-31}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 17:09, 23 May 2018
Gene CHC_T00002450001_1
- Synonym(s):
Reactions associated
- Reaction: TRANS-RXN1HP7-31
- Source: orthology-galdieria.sulphuraria