Difference between revisions of "RXN-1225"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-469 CPD-469] == * smiles: ** CC(=O)NC(C([O-])=O)CC[CH]=O * inchi key: ** InChIKey=BCPSFKBPH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1225 RXN-1225] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1225 RXN-1225] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.4.1.241 EC-2.4.1.241] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[D-Galactosyl-12-diacyl-glycerols]][c] '''+''' 1 [[CPD-14553]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c] '''+''' 1 [[Galactosyl-galactosyl-diacyl-glycerols]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 a 1,2-diacyl-3-O-(β-D-galactopyranosyl)-sn-glycerol[c] '''+''' 1 UDP-α-D-galactose[c] '''=>''' 1 H+[c] '''+''' 1 UDP[c] '''+''' 1 an α,β-digalactosyldiacylglycerol[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00008344001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-401]], galactolipid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-401 PWY-401] | ||
+ | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-7666]], galactolipid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7666 PWY-7666] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10520 10520] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04469 R04469] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-2.4.1.241}} |
− | + | {{#set: gene associated=CHC_T00008344001_1}} | |
− | + | {{#set: in pathway=PWY-401|PWY-7666}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-ectocarpus_siliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:12, 23 May 2018
Contents
Reaction RXN-1225
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 D-Galactosyl-12-diacyl-glycerols[c] + 1 CPD-14553[c] => 1 PROTON[c] + 1 UDP[c] + 1 Galactosyl-galactosyl-diacyl-glycerols[c]
- With common name(s):
- 1 a 1,2-diacyl-3-O-(β-D-galactopyranosyl)-sn-glycerol[c] + 1 UDP-α-D-galactose[c] => 1 H+[c] + 1 UDP[c] + 1 an α,β-digalactosyldiacylglycerol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008344001_1
- Source: orthology-ectocarpus_siliculosus
Pathways
- PWY-401, galactolipid biosynthesis I: PWY-401
- 2 reactions found over 5 reactions in the full pathway
- PWY-7666, galactolipid biosynthesis II: PWY-7666
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
External links