Difference between revisions of "CPD-17399"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-ACETO-ACETYL-COA 2-METHYL-ACETO-ACETYL-COA] == * smiles: ** CC(C(SCCNC(=O)CCNC(=O)C(O)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17399 CPD-17399] == * common name: ** a [glycerolipid]-auricolate * Synonym(s): ** a [glyce...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-ACETO-ACETYL-COA 2-METHYL-ACETO-ACETYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17399 CPD-17399] ==
−
* smiles:
+
−
** CC(C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)C(=O)C
+
−
* inchi key:
+
−
** InChIKey=NHNODHRSCRALBF-NQNBQJKNSA-J
+
 
* common name:
 
* common name:
−
** 2-methylacetoacetyl-CoA
+
** a [glycerolipid]-auricolate
−
* molecular weight:
+
−
** 861.604   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-methyl-3-acetoacetyl-CoA
+
** a [glycerolipid]-(11Z,17Z)-14R-hydroxy-eicosa-11,17-dienoate
−
** 2-methylacetoacetyl coenzyme A
+
** a [glycerolipid]-auricolic acid
 +
** a [glycerolipid]-(11Z,17Z)-14R-hydroxy-icosa-11,17-dienoate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[METHYLACETOACETYLCOATHIOL-RXN]]
+
* [[RXN-16157]]
 
== External links  ==
 
== External links  ==
−
* CAS : 6712-01-2
+
{{#set: common name=a [glycerolipid]-auricolate}}
−
* PUBCHEM:
+
{{#set: common name=a [glycerolipid]-(11Z,17Z)-14R-hydroxy-eicosa-11,17-dienoate|a [glycerolipid]-auricolic acid|a [glycerolipid]-(11Z,17Z)-14R-hydroxy-icosa-11,17-dienoate}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266568 45266568]
+
{{#set: reversible reaction associated=RXN-16157}}
−
* HMDB : HMDB01157
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C03344 C03344]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57335 57335]
+
−
* METABOLIGHTS : MTBLC57335
+
−
{{#set: smiles=CC(C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)C(=O)C}}
+
−
{{#set: inchi key=InChIKey=NHNODHRSCRALBF-NQNBQJKNSA-J}}
+
−
{{#set: common name=2-methylacetoacetyl-CoA}}
+
−
{{#set: molecular weight=861.604    }}
+
−
{{#set: common name=2-methyl-3-acetoacetyl-CoA|2-methylacetoacetyl coenzyme A}}
+
−
{{#set: consumed or produced by=METHYLACETOACETYLCOATHIOL-RXN}}
+

Latest revision as of 16:14, 23 May 2018

Metabolite CPD-17399

  • common name:
    • a [glycerolipid]-auricolate
  • Synonym(s):
    • a [glycerolipid]-(11Z,17Z)-14R-hydroxy-eicosa-11,17-dienoate
    • a [glycerolipid]-auricolic acid
    • a [glycerolipid]-(11Z,17Z)-14R-hydroxy-icosa-11,17-dienoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [glycerolipid]-auricolate" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-(11Z,17Z)-14R-hydroxy-eicosa-11,17-dienoate" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-auricolic acid" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-(11Z,17Z)-14R-hydroxy-icosa-11,17-dienoate" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-17399&oldid=16569"