Difference between revisions of "N-terminal-L-cysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2106 CPD0-2106] == * smiles: ** CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-cysteine N-terminal-L-cysteine] == * common name: ** an N-terminal L-cysteinyl-[pr...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2106 CPD0-2106] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-cysteine N-terminal-L-cysteine] ==
* smiles:
+
** CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=WPIVBCGRGVNDDT-CECATXLMSA-J
+
 
* common name:
 
* common name:
** 3-oxooctanoyl-CoA
+
** an N-terminal L-cysteinyl-[protein]
* molecular weight:
+
** 903.684   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** an N-terminal [protein]-L-cysteine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17874]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-14277]]
 
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=an N-terminal L-cysteinyl-[protein]}}
** [http://www.genome.jp/dbget-bin/www_bget?C05267 C05267]
+
{{#set: common name=an N-terminal [protein]-L-cysteine}}
* CHEBI:
+
{{#set: produced by=RXN-17874}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62619 62619]
+
* BIGG : 3oocoa
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173417 46173417]
+
* HMDB : HMDB03941
+
{{#set: smiles=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=WPIVBCGRGVNDDT-CECATXLMSA-J}}
+
{{#set: common name=3-oxooctanoyl-CoA}}
+
{{#set: molecular weight=903.684    }}
+
{{#set: consumed or produced by=RXN-14277}}
+

Latest revision as of 17:18, 23 May 2018

Metabolite N-terminal-L-cysteine

  • common name:
    • an N-terminal L-cysteinyl-[protein]
  • Synonym(s):
    • an N-terminal [protein]-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal L-cysteinyl-[protein" cannot be used as a page name in this wiki.
"an N-terminal [protein]-L-cysteine" cannot be used as a page name in this wiki.