Difference between revisions of "CPD-2742"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7222 CPD-7222] == * smiles: ** CCCCCCCCCC=CC(SCCNC(CCNC(C(C(COP(OP(OCC3(OC(N2(C1(=C(C(=NC=N...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == * smiles: ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N |
* common name: | * common name: | ||
− | ** | + | ** cotinine |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 176.218 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN66-169]] | ||
+ | * [[RXN66-161]] | ||
+ | * [[RXN66-163]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=854019 854019] |
− | * | + | * CHEMSPIDER: |
− | + | ** [http://www.chemspider.com/Chemical-Structure.746405.html 746405] | |
− | ** [http://www. | + | |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68641 68641] |
− | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC68641 |
− | {{#set: smiles= | + | * HMDB : HMDB01046 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N}} |
− | {{#set: molecular weight= | + | {{#set: common name=cotinine}} |
− | {{#set: | + | {{#set: molecular weight=176.218 }} |
− | + | {{#set: consumed by=RXN66-169|RXN66-161|RXN66-163}} |
Revision as of 16:19, 23 May 2018
Contents
Metabolite CPD-2742
- smiles:
- C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))
- inchi key:
- InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N
- common name:
- cotinine
- molecular weight:
- 176.218
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.