Difference between revisions of "Phosphatase-2A-leucine-methyl-ester"

Latest revision as of 16:21, 23 May 2018

"a [phosphatase 2A protein] C-terminal L-leucine methyl ester" cannot be used as a page name in this wiki.

"a C-terminal [phosphatase 2A protein]-leucine methyl ester" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphatase-2A-leucine-methyl-ester Phosphatase-2A-leucine-methyl-ester] ==
-* smiles:
-** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)
-* inchi key:
-** InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K
 * common name:
-** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
+** a [phosphatase 2A protein] C-terminal L-leucine methyl ester
-* molecular weight:
-** 264.169
 * Synonym(s):
-** cThz-P
+** a C-terminal [phosphatase 2A protein]-leucine methyl ester
 == Reaction(s) known to consume the compound ==
-* [[RXN-12610]]
+* [[RXN-12322]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* PUBCHEM:
+{{#set: common name=a [phosphatase 2A protein] C-terminal L-leucine methyl ester}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477624 53477624]
+{{#set: common name=a C-terminal [phosphatase 2A protein]-leucine methyl ester}}
-* CHEBI:
+{{#set: consumed by=RXN-12322}}
-** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62890 62890]
-{{#set: smiles=CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)}}
-{{#set: inchi key=InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K}}
-{{#set: common name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}}
-{{#set: molecular weight=264.169    }}
-{{#set: common name=cThz-P}}
-{{#set: consumed by=RXN-12610}}