Difference between revisions of "3-HEXAPRENYL-45-DIHYDROXYBENZOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYLTHIOADENOSINE 5-METHYLTHIOADENOSINE] == * smiles: ** CSCC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-45-DIHYDROXYBENZOATE 3-HEXAPRENYL-45-DIHYDROXYBENZOATE] == * smiles: ** CC(=CCCC(=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-45-DIHYDROXYBENZOATE 3-HEXAPRENYL-45-DIHYDROXYBENZOATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=VEPICJBQCOUQPI-IRVXXIIISA-M |
* common name: | * common name: | ||
− | ** | + | ** 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 561.823 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-(3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid |
− | + | ** 3-hexaprenyl-4,5-dihydroxybenzoate | |
− | + | ||
− | ** | + | |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.1.1.114-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54692919 54692919] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58373 58373] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05200 C05200] |
− | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB01063 |
− | {{#set: common name= | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=VEPICJBQCOUQPI-IRVXXIIISA-M}} |
− | {{#set: common name= | + | {{#set: common name=3,4-dihydroxy-5-all-trans-hexaprenylbenzoate}} |
− | + | {{#set: molecular weight=561.823 }} | |
− | {{#set: | + | {{#set: common name=3-(3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid|3-hexaprenyl-4,5-dihydroxybenzoate}} |
− | + | {{#set: consumed by=2.1.1.114-RXN}} |
Revision as of 16:23, 23 May 2018
Contents
Metabolite 3-HEXAPRENYL-45-DIHYDROXYBENZOATE
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C
- inchi key:
- InChIKey=VEPICJBQCOUQPI-IRVXXIIISA-M
- common name:
- 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
- molecular weight:
- 561.823
- Synonym(s):
- 3-(3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
- 3-hexaprenyl-4,5-dihydroxybenzoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C" cannot be used as a page name in this wiki.