Difference between revisions of "CPD-9898"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARACHIDONIC_ACID ARACHIDONIC_ACID] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCC(=O)[O-] * common na...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9898 CPD-9898] == * smiles: ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9898 CPD-9898] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C |
− | + | ||
− | + | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=FDPPBYXDOXRDHA-JSGWLJPKSA-M |
+ | * common name: | ||
+ | ** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 780.205 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-methoxy-4-hydroxy-5-nonaprenylbenzoate |
− | + | ** 3-(3,7,11,15,19,23-nonamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid | |
− | + | ** 3-nonaprenyl-4-hydroxy-5-methoxybenzoate | |
− | ** ( | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-9281]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54738025 54738025] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62791 62791] |
− | + | {{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=FDPPBYXDOXRDHA-JSGWLJPKSA-M}} |
− | {{#set: | + | {{#set: common name=3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate}} |
− | {{#set: | + | {{#set: molecular weight=780.205 }} |
− | {{#set: molecular weight= | + | {{#set: common name=3-methoxy-4-hydroxy-5-nonaprenylbenzoate|3-(3,7,11,15,19,23-nonamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid|3-nonaprenyl-4-hydroxy-5-methoxybenzoate}} |
− | {{#set: common name= | + | {{#set: produced by=RXN-9281}} |
− | {{#set: produced by=RXN- | + |
Revision as of 16:23, 23 May 2018
Contents
Metabolite CPD-9898
- smiles:
- CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=FDPPBYXDOXRDHA-JSGWLJPKSA-M
- common name:
- 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate
- molecular weight:
- 780.205
- Synonym(s):
- 3-methoxy-4-hydroxy-5-nonaprenylbenzoate
- 3-(3,7,11,15,19,23-nonamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid
- 3-nonaprenyl-4-hydroxy-5-methoxybenzoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.