Difference between revisions of "12-OXO-CIS-9-DODECENOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE ILE] == * smiles: ** CCC(C)C([N+])C(=O)[O-] * inchi key: ** InChIKey=AGPKZVBTJJNPAG-WHFBIAK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=12-OXO-CIS-9-DODECENOATE 12-OXO-CIS-9-DODECENOATE] == * smiles: ** [CH](=O)CC=CCCCCCCCC(=O)[O-]...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=12-OXO-CIS-9-DODECENOATE 12-OXO-CIS-9-DODECENOATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** [CH](=O)CC=CCCCCCCCC(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (9Z)-12-oxo-dodec-9-enoate |
+ | * inchi key: | ||
+ | ** InChIKey=KIHXTOVLSZRTHJ-ALCCZGGFSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 211.28 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 12-oxo-c-9-dodecenoate |
− | ** | + | ** 12-oxo-cis-9-dodecenoate |
− | ** | + | ** (9Z)-12-oxo-dodecenoate |
− | ** | + | ** 9Z-traumatin |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[HYDROHEX-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243932 25243932] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16311 C16311] |
− | + | {{#set: smiles=[CH](=O)CC=CCCCCCCCC(=O)[O-]}} | |
− | + | {{#set: common name=(9Z)-12-oxo-dodec-9-enoate}} | |
− | + | {{#set: inchi key=InChIKey=KIHXTOVLSZRTHJ-ALCCZGGFSA-M}} | |
− | {{#set: smiles= | + | {{#set: molecular weight=211.28 }} |
− | {{#set: | + | {{#set: common name=12-oxo-c-9-dodecenoate|12-oxo-cis-9-dodecenoate|(9Z)-12-oxo-dodecenoate|9Z-traumatin}} |
− | {{#set: | + | {{#set: produced by=HYDROHEX-RXN}} |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + |
Revision as of 16:25, 23 May 2018
Contents
Metabolite 12-OXO-CIS-9-DODECENOATE
- smiles:
- [CH](=O)CC=CCCCCCCCC(=O)[O-]
- common name:
- (9Z)-12-oxo-dodec-9-enoate
- inchi key:
- InChIKey=KIHXTOVLSZRTHJ-ALCCZGGFSA-M
- molecular weight:
- 211.28
- Synonym(s):
- 12-oxo-c-9-dodecenoate
- 12-oxo-cis-9-dodecenoate
- (9Z)-12-oxo-dodecenoate
- 9Z-traumatin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)CC=CCCCCCCCC(=O)[O-" cannot be used as a page name in this wiki.