Difference between revisions of "CPD-315"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00006421001_1 == * Synonym(s): == Reactions associated == * RXN-3701 ** pantograph-galdieria.sulphuraria == Pathways associated ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-315 CPD-315] == * smiles: ** CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-315 CPD-315] == |
| + | * smiles: | ||
| + | ** CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=RMRCNWBMXRMIRW-WZHZPDAFSA-L | ||
| + | * common name: | ||
| + | ** cyanocob(III)alamin | ||
| + | * molecular weight: | ||
| + | ** 1355.377 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** cyanocobalamin | ||
| + | ** rubramin | ||
| + | ** vitamin B12 | ||
| + | ** alphamine | ||
| + | ** crystamine | ||
| + | ** cyanoject | ||
| + | ** cyomin | ||
| + | ** cytamen | ||
| + | ** hydrobexan | ||
| + | ** rubesol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[TransportSeed_CPD-315]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[TransportSeed_CPD-315]] |
| + | == Reaction(s) of unknown directionality == | ||
| + | * [[ExchangeSeed_CPD-315]] | ||
== External links == | == External links == | ||
| − | {{#set: reaction associated= | + | * CAS : 68-19-9 |
| + | * DRUGBANK : DB00115 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678590 70678590] | ||
| + | * HMDB : HMDB00607 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02823 C02823] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17439 17439] | ||
| + | {{#set: smiles=CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12))))}} | ||
| + | {{#set: inchi key=InChIKey=RMRCNWBMXRMIRW-WZHZPDAFSA-L}} | ||
| + | {{#set: common name=cyanocob(III)alamin}} | ||
| + | {{#set: molecular weight=1355.377 }} | ||
| + | {{#set: common name=cyanocobalamin|rubramin|vitamin B12|alphamine|crystamine|cyanoject|cyomin|cytamen|hydrobexan|rubesol}} | ||
| + | {{#set: consumed by=TransportSeed_CPD-315}} | ||
| + | {{#set: produced by=TransportSeed_CPD-315}} | ||
| + | {{#set: reversible reaction associated=ExchangeSeed_CPD-315}} | ||
Revision as of 17:26, 23 May 2018
Contents
Metabolite CPD-315
- smiles:
- CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12))))
- inchi key:
- InChIKey=RMRCNWBMXRMIRW-WZHZPDAFSA-L
- common name:
- cyanocob(III)alamin
- molecular weight:
- 1355.377
- Synonym(s):
- cyanocobalamin
- rubramin
- vitamin B12
- alphamine
- crystamine
- cyanoject
- cyomin
- cytamen
- hydrobexan
- rubesol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12))))" cannot be used as a page name in this wiki.
