Difference between revisions of "CHC T00008716001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15691 CPD-15691] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(Created page with "Category:Gene == Gene CHC_T00008716001 == * left end position: ** 44852 * transcription direction: ** NEGATIVE * right end position: ** 48849 * centisome position: ** 91.4...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15691 CPD-15691] ==
+
== Gene CHC_T00008716001 ==
* smiles:
+
* left end position:
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 44852
* inchi key:
+
* transcription direction:
** InChIKey=VKLHSLOWDWGVGP-WOABMHMMSA-J
+
** NEGATIVE
* common name:
+
* right end position:
** 5-trans-3-oxo-dodecenoyl-CoA
+
** 48849
* molecular weight:
+
* centisome position:
** 957.775    
+
** 91.49548    
 
* Synonym(s):
 
* Synonym(s):
** 5E-3-oxo-dodecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14803]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=44852}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658857 90658857]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=48849}}
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-WOABMHMMSA-J}}
+
{{#set: centisome position=91.49548   }}
{{#set: common name=5-trans-3-oxo-dodecenoyl-CoA}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
{{#set: molecular weight=957.775   }}
+
{{#set: common name=5E-3-oxo-dodecenoyl-CoA}}
+
{{#set: consumed by=RXN-14803}}
+

Latest revision as of 16:28, 23 May 2018

Gene CHC_T00008716001

  • left end position:
    • 44852
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 48849
  • centisome position:
    • 91.49548
  • Synonym(s):

Reactions associated

Pathways associated

External links