Difference between revisions of "PORPHOBILSYNTH-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) * inchi key: ** InChIKey=KQR...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILSYNTH-RXN PORPHOBILSYNTH-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** delta-ami...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILSYNTH-RXN PORPHOBILSYNTH-RXN] ==
* smiles:
+
* direction:
** C(O)CC1(=CNC2(=C1C=C(O)C=C2))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 5-hydroxytryptophol
+
** delta-aminolevulinic acid dehydratase (porphobilinogen synthase)
* molecular weight:
+
* ec number:
** 177.202   
+
** [http://enzyme.expasy.org/EC/4.2.1.24 EC-4.2.1.24]
 
* Synonym(s):
 
* Synonym(s):
** hydroxytryptophol
 
** 5-hydroxyindole-3-ethanol
 
** 5-hydroxy-1H-indole-3-ethanol
 
** 1H-indole-3-ethanol, 5-hydroxy-
 
** indole-3-ethanol, 5-hydroxy-
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-10781]]
+
** 2 [[5-AMINO-LEVULINATE]][c] '''=>''' 1 [[PORPHOBILINOGEN]][c] '''+''' 2 [[WATER]][c] '''+''' 1 [[PROTON]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2 5-aminolevulinate[c] '''=>''' 1 porphobilinogen[c] '''+''' 2 H2O[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008491001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008491001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
* [[PWY-5189]], tetrapyrrole biosynthesis II (from glycine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5189 PWY-5189]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
* [[PWY-5188]], tetrapyrrole biosynthesis I (from glutamate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5188 PWY-5188]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9061 9061]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24064 24064]
* CHEMSPIDER:
+
* LIGAND-RXN:
** [http://www.chemspider.com/Chemical-Structure.8708.html 8708]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00036 R00036]
* HMDB : HMDB01855
+
* UNIPROT:
{{#set: smiles=C(O)CC1(=CNC2(=C1C=C(O)C=C2))}}
+
** [http://www.uniprot.org/uniprot/P06214 P06214]
{{#set: inchi key=InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N}}
+
** [http://www.uniprot.org/uniprot/P13716 P13716]
{{#set: common name=5-hydroxytryptophol}}
+
** [http://www.uniprot.org/uniprot/Q7M315 Q7M315]
{{#set: molecular weight=177.202    }}
+
** [http://www.uniprot.org/uniprot/P30124 P30124]
{{#set: common name=hydroxytryptophol|5-hydroxyindole-3-ethanol|5-hydroxy-1H-indole-3-ethanol|1H-indole-3-ethanol, 5-hydroxy-|indole-3-ethanol, 5-hydroxy-}}
+
** [http://www.uniprot.org/uniprot/Q9JV37 Q9JV37]
{{#set: produced by=RXN-10781}}
+
** [http://www.uniprot.org/uniprot/P30950 P30950]
 +
** [http://www.uniprot.org/uniprot/Q60178 Q60178]
 +
** [http://www.uniprot.org/uniprot/Q9PNU5 Q9PNU5]
 +
** [http://www.uniprot.org/uniprot/Q59295 Q59295]
 +
** [http://www.uniprot.org/uniprot/Q02250 Q02250]
 +
** [http://www.uniprot.org/uniprot/P10518 P10518]
 +
** [http://www.uniprot.org/uniprot/Q43148 Q43148]
 +
** [http://www.uniprot.org/uniprot/Q42682 Q42682]
 +
** [http://www.uniprot.org/uniprot/Q43058 Q43058]
 +
** [http://www.uniprot.org/uniprot/Q59643 Q59643]
 +
** [http://www.uniprot.org/uniprot/Q9S8B1 Q9S8B1]
 +
** [http://www.uniprot.org/uniprot/P05373 P05373]
 +
** [http://www.uniprot.org/uniprot/P0ACB2 P0ACB2]
 +
** [http://www.uniprot.org/uniprot/Q42836 Q42836]
 +
** [http://www.uniprot.org/uniprot/P43210 P43210]
 +
** [http://www.uniprot.org/uniprot/Q9ZNC9 Q9ZNC9]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: common name=delta-aminolevulinic acid dehydratase (porphobilinogen synthase)}}
 +
{{#set: ec number=EC-4.2.1.24}}
 +
{{#set: gene associated=CHC_T00008491001|CHC_T00008491001_1}}
 +
{{#set: in pathway=PWY-5189|PWY-5188}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-original_genome|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 16:30, 23 May 2018

Reaction PORPHOBILSYNTH-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • delta-aminolevulinic acid dehydratase (porphobilinogen synthase)
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5189, tetrapyrrole biosynthesis II (from glycine): PWY-5189
    • 4 reactions found over 4 reactions in the full pathway
  • PWY-5188, tetrapyrrole biosynthesis I (from glutamate): PWY-5188
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links