Difference between revisions of "CPD-7030"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_PPI TransportSeed_PPI] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Fo...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7030 CPD-7030] == * smiles: ** CC(C)C(CC([O-])=O)=O * common name: ** β-ketoisocaproat...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7030 CPD-7030] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(CC([O-])=O)=O |
| + | * common name: | ||
| + | ** β-ketoisocaproate | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZXLSKTZECNUVIS-UHFFFAOYSA-M | ||
| + | * molecular weight: | ||
| + | ** 129.135 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-methyl-3-oxopentanoate | ||
| + | ** 3-oxo-4-methylpentanoate | ||
| + | ** β-oxo-4-methylcaproate | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-7691]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-7690]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22019185 22019185] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10755343.html 10755343] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62222 62222] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03467 C03467] | ||
| + | {{#set: smiles=CC(C)C(CC([O-])=O)=O}} | ||
| + | {{#set: common name=β-ketoisocaproate}} | ||
| + | {{#set: inchi key=InChIKey=ZXLSKTZECNUVIS-UHFFFAOYSA-M}} | ||
| + | {{#set: molecular weight=129.135 }} | ||
| + | {{#set: common name=4-methyl-3-oxopentanoate|3-oxo-4-methylpentanoate|β-oxo-4-methylcaproate}} | ||
| + | {{#set: consumed by=RXN-7691}} | ||
| + | {{#set: produced by=RXN-7690}} | ||
Revision as of 16:30, 23 May 2018
Contents
Metabolite CPD-7030
- smiles:
- CC(C)C(CC([O-])=O)=O
- common name:
- β-ketoisocaproate
- inchi key:
- InChIKey=ZXLSKTZECNUVIS-UHFFFAOYSA-M
- molecular weight:
- 129.135
- Synonym(s):
- 4-methyl-3-oxopentanoate
- 3-oxo-4-methylpentanoate
- β-oxo-4-methylcaproate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(CC([O-])=O)=O" cannot be used as a page name in this wiki.
