Difference between revisions of "CHC T00008383001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18841 CPD-18841] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(...")
 
(Created page with "Category:Gene == Gene CHC_T00008383001_1 == * Synonym(s): == Reactions associated == * Reaction: CHOLINE-KINASE-RXN ** Source: orthology-galdieria.sulphuraria **...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18841 CPD-18841] ==
+
== Gene CHC_T00008383001_1 ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-]C5=C(N67)8)))))9))))
+
* common name:
+
** 8-ethyl-12-methyl-3-vinyl-bacteriochlorophyllide d
+
* molecular weight:
+
** 554.93   
+
 
* Synonym(s):
 
* Synonym(s):
** 3V[E,M]-bacteriochlorophyllide d
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[CHOLINE-KINASE-RXN]]
* [[RXN-17429]]
+
** Source: [[orthology-galdieria.sulphuraria]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Reaction: [[ETHANOLAMINE-KINASE-RXN]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7782]]
 +
* [[PWY-7818]]
 +
* [[PWY4FS-6]]
 +
* [[PWY-3385]]
 +
* [[PWY3O-450]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-]C5=C(N67)8)))))9))))}}
+
{{#set: reaction associated=CHOLINE-KINASE-RXN|ETHANOLAMINE-KINASE-RXN}}
{{#set: common name=8-ethyl-12-methyl-3-vinyl-bacteriochlorophyllide d}}
+
{{#set: pathway associated=PWY-7782|PWY-7818|PWY4FS-6|PWY-3385|PWY3O-450}}
{{#set: molecular weight=554.93    }}
+
{{#set: common name=3V[E,M]-bacteriochlorophyllide d}}
+
{{#set: produced by=RXN-17429}}
+

Revision as of 17:32, 23 May 2018

Gene CHC_T00008383001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links