Difference between revisions of "CHC T00009466001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15839 CPD-15839] == * smiles: ** CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=CC(=CC=2C)O)))C)C)C *...") |
(Created page with "Category:Gene == Gene CHC_T00009466001 == * left end position: ** 245036 * transcription direction: ** NEGATIVE * right end position: ** 245981 * centisome position: ** 43...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CHC_T00009466001 == |
| − | * | + | * left end position: |
| − | ** | + | ** 245036 |
| − | * | + | * transcription direction: |
| − | ** | + | ** NEGATIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 245981 |
| − | * | + | * centisome position: |
| − | ** | + | ** 43.922787 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[RXN-15556]] |
| − | + | ** Source: [[annotation-original_genome]] | |
| − | == | + | *** Assignment: automated-name-match |
| + | == Pathways associated == | ||
| + | * [[PWY-7511]] | ||
== External links == | == External links == | ||
| − | + | {{#set: left end position=245036}} | |
| − | + | {{#set: transcription direction=NEGATIVE}} | |
| − | + | {{#set: right end position=245981}} | |
| − | + | {{#set: centisome position=43.922787 }} | |
| − | + | {{#set: reaction associated=RXN-15556}} | |
| − | + | {{#set: pathway associated=PWY-7511}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 16:32, 23 May 2018
Gene CHC_T00009466001
- left end position:
- 245036
- transcription direction:
- NEGATIVE
- right end position:
- 245981
- centisome position:
- 43.922787
- Synonym(s):
Reactions associated
- Reaction: RXN-15556
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
