Difference between revisions of "INDOLE-3-GLYCOL"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00010324001_1 == * Synonym(s): == Reactions associated == * RXN-8443 ** pantograph-a.taliana == Pathways associated == * PWY-5381...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(O)CO) * inchi key: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == |
+ | * smiles: | ||
+ | ** C2(=C(C1(C=CC=CC=1N2))C(O)CO) | ||
+ | * inchi key: | ||
+ | ** InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** indole-3-glycol | ||
+ | * molecular weight: | ||
+ | ** 177.202 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-5424]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202910 25202910] |
+ | {{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(O)CO)}} | ||
+ | {{#set: inchi key=InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=indole-3-glycol}} | ||
+ | {{#set: molecular weight=177.202 }} | ||
+ | {{#set: produced by=RXN-5424}} |
Revision as of 17:35, 23 May 2018
Contents
Metabolite INDOLE-3-GLYCOL
- smiles:
- C2(=C(C1(C=CC=CC=1N2))C(O)CO)
- inchi key:
- InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N
- common name:
- indole-3-glycol
- molecular weight:
- 177.202
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: