Difference between revisions of "CPD-9895"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008467001_1 == * Synonym(s): == Reactions associated == * NADH-DEHYDROG-A-RXN ** pantograph-galdieria.sulphuraria == Pathways ass...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9895 CPD-9895] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9895 CPD-9895] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C)C)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=HGWUGDIATLOPBN-BHZQGFRMSA-M | ||
+ | * common name: | ||
+ | ** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate | ||
+ | * molecular weight: | ||
+ | ** 834.296 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid | ||
+ | ** 3-decaprenyl-4,5-dihydroxybenzoate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-9282]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-9279]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54738022 54738022] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62793 62793] | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=HGWUGDIATLOPBN-BHZQGFRMSA-M}} | ||
+ | {{#set: common name=3,4-dihydroxy-5-all-trans-decaprenylbenzoate}} | ||
+ | {{#set: molecular weight=834.296 }} | ||
+ | {{#set: common name=3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid|3-decaprenyl-4,5-dihydroxybenzoate}} | ||
+ | {{#set: consumed by=RXN-9282}} | ||
+ | {{#set: produced by=RXN-9279}} |
Revision as of 16:35, 23 May 2018
Contents
Metabolite CPD-9895
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=HGWUGDIATLOPBN-BHZQGFRMSA-M
- common name:
- 3,4-dihydroxy-5-all-trans-decaprenylbenzoate
- molecular weight:
- 834.296
- Synonym(s):
- 3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
- 3-decaprenyl-4,5-dihydroxybenzoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.