Difference between revisions of "CHC T00010321001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ANTHRANILATE 3-HYDROXY-ANTHRANILATE] == * smiles: ** C1(C=C(C(N)=C(O)C=1)C([O-])=O) *...") |
(Created page with "Category:Gene == Gene CHC_T00010321001 == * left end position: ** 142567 * transcription direction: ** NEGATIVE * right end position: ** 143678 * centisome position: ** 99...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00010321001 == |
− | * | + | * left end position: |
− | ** | + | ** 142567 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 143678 |
− | * | + | * centisome position: |
− | ** | + | ** 99.17222 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[CARBODEHYDRAT-RXN]] |
− | == | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | * Reaction: [[RXN0-5224]] | |
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-241]] | ||
+ | * [[PWYQT-4429]] | ||
+ | * [[PWY-7117]] | ||
+ | * [[PWY-7115]] | ||
+ | * [[PWY-6142]] | ||
+ | * [[CYANCAT-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=142567}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=143678}} | |
− | + | {{#set: centisome position=99.17222 }} | |
− | + | {{#set: reaction associated=CARBODEHYDRAT-RXN|RXN0-5224}} | |
− | + | {{#set: pathway associated=PWY-241|PWYQT-4429|PWY-7117|PWY-7115|PWY-6142|CYANCAT-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:37, 23 May 2018
Gene CHC_T00010321001
- left end position:
- 142567
- transcription direction:
- NEGATIVE
- right end position:
- 143678
- centisome position:
- 99.17222
- Synonym(s):
Reactions associated
- Reaction: CARBODEHYDRAT-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN0-5224
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome