Difference between revisions of "CPD-592"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] == * smiles: ** CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-592 CPD-592] == * smiles: ** C([O-])(=O)CCCNC(=[N+])N * inchi key: ** InChIKey=TUHVEAJXIMEO...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-592 CPD-592] == |
* smiles: | * smiles: | ||
− | ** | + | ** C([O-])(=O)CCCNC(=[N+])N |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N |
* common name: | * common name: | ||
− | ** | + | ** 4-guanidinobutanoate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 145.161 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4-guanido-butyrate |
+ | ** γ-guanidinobutyrate | ||
+ | ** 4-guanidinobutyrate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GUANIDINOBUTYRASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[GUANIDINOBUTANAMIDE-NH3-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01035 C01035] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57486 57486] | ||
+ | * METABOLIGHTS : MTBLC57486 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200642 25200642] |
− | {{#set: smiles= | + | * HMDB : HMDB03464 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C([O-])(=O)CCCNC(=[N+])N}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N}} |
− | {{#set: molecular weight= | + | {{#set: common name=4-guanidinobutanoate}} |
− | {{#set: common name= | + | {{#set: molecular weight=145.161 }} |
− | {{#set: consumed by=RXN- | + | {{#set: common name=4-guanido-butyrate|γ-guanidinobutyrate|4-guanidinobutyrate}} |
+ | {{#set: consumed by=GUANIDINOBUTYRASE-RXN}} | ||
+ | {{#set: produced by=GUANIDINOBUTANAMIDE-NH3-RXN}} |
Revision as of 17:38, 23 May 2018
Contents
Metabolite CPD-592
- smiles:
- C([O-])(=O)CCCNC(=[N+])N
- inchi key:
- InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N
- common name:
- 4-guanidinobutanoate
- molecular weight:
- 145.161
- Synonym(s):
- 4-guanido-butyrate
- γ-guanidinobutyrate
- 4-guanidinobutyrate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)CCCNC(=[N+])N" cannot be used as a page name in this wiki.