Difference between revisions of "CPD-4127"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00009577001 == * left end position: ** 296346 * transcription direction: ** NEGATIVE * right end position: ** 297476 * centisome position: ** 93...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00009577001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
* left end position:
+
* smiles:
** 296346
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
* right end position:
+
* common name:
** 297476
+
** isofucosterol
* centisome position:
+
* molecular weight:
** 93.20288    
+
** 412.698    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[CDPDIGLYSYN-RXN]]
+
== Reaction(s) known to produce the compound ==
** original_genome
+
* [[RXN-4210]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
* [[RXN0-5515]]
+
** original_genome
+
***automated-name-match
+
== Pathways associated ==
+
* [[PWY-7817]]
+
* [[PWY-5667]]
+
* [[PWY0-1319]]
+
* [[PWY-5981]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=296346}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281326 5281326]
{{#set: right end position=297476}}
+
* LIGAND-CPD:
{{#set: centisome position=93.20288    }}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821]
{{#set: reaction associated=CDPDIGLYSYN-RXN|RXN0-5515}}
+
* HMDB : HMDB02374
{{#set: pathway associated=PWY-7817|PWY-5667|PWY0-1319|PWY-5981}}
+
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}}
 +
{{#set: common name=isofucosterol}}
 +
{{#set: molecular weight=412.698    }}
 +
{{#set: produced by=RXN-4210}}

Revision as of 17:38, 23 May 2018

Metabolite CPD-4127

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
  • common name:
    • isofucosterol
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.