Difference between revisions of "THIOSULFATE-SULFURTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == * smiles: ** CC(=O)C(O)COP(=O)([O-])[O-] * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIOSULFATE-SULFURTRANSFERASE-RXN THIOSULFATE-SULFURTRANSFERASE-RXN] == * direction: ** LEFT-TO-RIG...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIOSULFATE-SULFURTRANSFERASE-RXN THIOSULFATE-SULFURTRANSFERASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.8.1.1 EC-2.8.1.1] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[S2O3]][c] '''+''' 1 [[HCN]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[SO3]][c] '''+''' 1 [[HSCN]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 thiosulfate[c] '''+''' 1 hydrogen cyanide[c] '''=>''' 2 H+[c] '''+''' 1 sulfite[c] '''+''' 1 thiocyanate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00008822001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5350]], thiosulfate disproportionation IV (rhodanese): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5350 PWY-5350] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16881 16881] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01931 R01931] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P25324 P25324] |
− | * | + | ** [http://www.uniprot.org/uniprot/P52196 P52196] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q16762 Q16762] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P00586 P00586] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P25325 P25325] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P24329 P24329] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P52197 P52197] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O64530 O64530] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O50573 O50573] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9M4F7 Q9M4F7] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9SCY8 Q9SCY8] |
+ | ** [http://www.uniprot.org/uniprot/Q9S7Y9 Q9S7Y9] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: ec number=EC-2.8.1.1}} | ||
+ | {{#set: gene associated=CHC_T00008822001_1}} | ||
+ | {{#set: in pathway=PWY-5350}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-ectocarpus_siliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Revision as of 16:39, 23 May 2018
Contents
Reaction THIOSULFATE-SULFURTRANSFERASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 thiosulfate[c] + 1 hydrogen cyanide[c] => 2 H+[c] + 1 sulfite[c] + 1 thiocyanate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008822001_1
- Source: orthology-ectocarpus_siliculosus
Pathways
- PWY-5350, thiosulfate disproportionation IV (rhodanese): PWY-5350
- 1 reactions found over 1 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: