Difference between revisions of "CPD-18778"

Revision as of 16:40, 23 May 2018

"COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene CHC_T00009394001 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18778 CPD-18778] ==
-* left end position:
+* smiles:
-** 69544
+** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)
-* transcription direction:
+* common name:
-** POSITIVE
+** shinorine
-* right end position:
+* inchi key:
-** 70371
+** InChIKey=WXEQFJUHQIGKNG-MZNRBSSJSA-L
-* centisome position:
+* molecular weight:
-** 85.64637
+** 330.294
 * Synonym(s):
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[PROTEIN-KINASE-RXN]]
+* [[extended_PHOSPHASERDECARB-RXN_CPD-18778]]
-** original_genome
+== Reaction(s) known to produce the compound ==
-***automated-name-match
+== Reaction(s) of unknown directionality ==
-== Pathways associated ==
+* [[RXN-17371]]
 == External links  ==
-{{#set: left end position=69544}}
+{{#set: smiles=COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)}}
-{{#set: transcription direction=POSITIVE}}
+{{#set: common name=shinorine}}
-{{#set: right end position=70371}}
+{{#set: inchi key=InChIKey=WXEQFJUHQIGKNG-MZNRBSSJSA-L}}
-{{#set: centisome position=85.64637    }}
+{{#set: molecular weight=330.294    }}
-{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+{{#set: consumed by=extended_PHOSPHASERDECARB-RXN_CPD-18778}}
+{{#set: reversible reaction associated=RXN-17371}}