Difference between revisions of "RXN-600"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] == * smiles: ** C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-600 RXN-600] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.1....") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-600 RXN-600] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.219 EC-1.1.1.219] |
− | * | + | |
− | ** 1 | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[1 | + | * With identifiers: |
− | = | + | ** 2 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[CPD-474]][c] '''=>''' 1 [[CPD-590]][c] '''+''' 1 [[NADP]][c] |
− | = | + | * With common name(s): |
− | * [[ | + | ** 2 H+[c] '''+''' 1 NADPH[c] '''+''' 1 (+)-taxifolin[c] '''=>''' 1 (2R,3S,4S)-leucocyanidin[c] '''+''' 1 NADP+[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00009538001_1]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | == Pathways == | ||
+ | * [[PWY1F-823]], leucopelargonidin and leucocyanidin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-823 PWY1F-823] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03636 R03636] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.1.1.219}} | |
− | + | {{#set: gene associated=CHC_T00009538001_1}} | |
− | * LIGAND- | + | {{#set: in pathway=PWY1F-823}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=orthology}} |
− | + | {{#set: reconstruction source=orthology-arabidopsis_thaliana}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:41, 23 May 2018
Contents
Reaction RXN-600
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 2 H+[c] + 1 NADPH[c] + 1 (+)-taxifolin[c] => 1 (2R,3S,4S)-leucocyanidin[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009538001_1
- Source: orthology-arabidopsis_thaliana
Pathways
- PWY1F-823, leucopelargonidin and leucocyanidin biosynthesis: PWY1F-823
- 2 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-arabidopsis_thaliana
- Tool: pantograph
- Source: orthology-arabidopsis_thaliana
External links
- LIGAND-RXN: