Difference between revisions of "TRANS-RXN1HP7-26"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11444 CPD-11444] == * smiles: ** C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-26 TRANS-RXN1HP7-26] == * direction: ** LEFT-TO-RIGHT * common name: ** TRANS-RXN1HP7...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11444 CPD-11444] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-26 TRANS-RXN1HP7-26] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F
+
 
* common name:
 
* common name:
−
** uroporphyrinogen-I
+
** TRANS-RXN1HP7-26
−
* molecular weight:
+
−
** 828.742   
+
 
* Synonym(s):
 
* Synonym(s):
−
** uroporphyrinogen I
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1.0 [[ATP]][c] '''+''' 1.0 [[NITRATE]][e] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[NITRATE]][c] '''+''' 1.0 [[ADP]][c]
−
* [[RXN-10642]]
+
* With common name(s):
 +
** 1.0 ATP[c] '''+''' 1.0 nitrate[e] '''+''' 1.0 H2O[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 nitrate[c] '''+''' 1.0 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00000780001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201940 25201940]
+
{{#set: common name=TRANS-RXN1HP7-26}}
−
* CHEMSPIDER:
+
{{#set: gene associated=CHC_T00000780001_1}}
−
** [http://www.chemspider.com/Chemical-Structure.389644.html 389644]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62626 62626]
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05766 C05766]
+
−
* HMDB : HMDB02211
+
−
{{#set: smiles=C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))}}
+
−
{{#set: inchi key=InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F}}
+
−
{{#set: common name=uroporphyrinogen-I}}
+
−
{{#set: molecular weight=828.742    }}
+
−
{{#set: common name=uroporphyrinogen I}}
+
−
{{#set: consumed or produced by=RXN-10642}}
+

Latest revision as of 17:47, 23 May 2018

Reaction TRANS-RXN1HP7-26

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • TRANS-RXN1HP7-26
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[c] + 1.0 nitrate[e] + 1.0 H2O[c] => 1.0 phosphate[c] + 1.0 nitrate[c] + 1.0 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=TRANS-RXN1HP7-26&oldid=18110"